C16H20FNO5 — CID 70941230
(2S)-2-amino-4-[[4-(3-fluorocyclobutyl)oxyphenyl]methyl]pentanedioic acid (PubChem CID 70941230) has the molecular formula C16H20FNO5 and a molecular weight of 325.34 g/mol. Its IUPAC name is (2S)-2-amino-4-[[4-(3-fluorocyclobutyl)oxyphenyl]methyl]pentanedioic acid.
| Compound Name | (2S)-2-amino-4-[[4-(3-fluorocyclobutyl)oxyphenyl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 70941230 |
| Molecular Formula | C16H20FNO5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2S)-2-amino-4-[[4-(3-fluorocyclobutyl)oxyphenyl]methyl]pentanedioic acid |
| SMILES | N[C@@H](CC(Cc1ccc(OC2CC(F)C2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20FNO5/c17-11-7-13(8-11)23-12-3-1-9(2-4-12)5-10(15(19)20)6-14(18)16(21)22/h1-4,10-11,13-14H,5-8,18H2,(H,19,20)(H,21,22)/t10?,11?,13?,14-/m0/s1 |
| InChIKey | RMIKRMSYEYOBQY-CGTPWUTKSA-N |
| XLogP | 1.61 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |