C12H12FNO7 — CID 4631018
2-[4-(2-amino-2-carboxyethyl)phenoxy]-2-fluoropropanedioic acid (PubChem CID 4631018) has the molecular formula C12H12FNO7 and a molecular weight of 301.23 g/mol. Its IUPAC name is 2-[4-(2-amino-2-carboxyethyl)phenoxy]-2-fluoropropanedioic acid.
| Compound Name | 2-[4-(2-amino-2-carboxyethyl)phenoxy]-2-fluoropropanedioic acid |
|---|---|
| PubChem CID | 4631018 |
| Molecular Formula | C12H12FNO7 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[4-(2-amino-2-carboxyethyl)phenoxy]-2-fluoropropanedioic acid |
| SMILES | NC(Cc1ccc(OC(F)(C(=O)O)C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C12H12FNO7/c13-12(10(17)18,11(19)20)21-7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | AXIAXCQZCZMCQW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|