C20H28N2O8 — CID 67898823
(2S)-2-amino-4-benzylpentanedioic acid;(2S)-2-amino-4-prop-2-enylpentanedioic acid (PubChem CID 67898823) has the molecular formula C20H28N2O8 and a molecular weight of 424.45 g/mol. Its IUPAC name is (2S)-2-amino-4-benzylpentanedioic acid;(2S)-2-amino-4-prop-2-enylpentanedioic acid.
| Compound Name | (2S)-2-amino-4-benzylpentanedioic acid;(2S)-2-amino-4-prop-2-enylpentanedioic acid |
|---|---|
| PubChem CID | 67898823 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2S)-2-amino-4-benzylpentanedioic acid;(2S)-2-amino-4-prop-2-enylpentanedioic acid |
| SMILES | C=CCC(C[C@H](N)C(=O)O)C(=O)O.N[C@@H](CC(Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H15NO4.C8H13NO4/c13-10(12(16)17)7-9(11(14)15)6-8-4-2-1-3-5-8;1-2-3-5(7(10)11)4-6(9)8(12)13/h1-5,9-10H,6-7,13H2,(H,14,15)(H,16,17);2,5-6H,1,3-4,9H2,(H,10,11)(H,12,13)/t9?,10-;5?,6-/m00/s1 |
| InChIKey | QPJZZRYBIDPKEC-AMNWGPAOSA-N |
| XLogP | 0.80 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|