C15H21NO4S — CID 69031048
2-amino-3-phenylpropanoic acid;3-prop-2-enylsulfonylprop-1-ene (PubChem CID 69031048) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;3-prop-2-enylsulfonylprop-1-ene.
| Compound Name | 2-amino-3-phenylpropanoic acid;3-prop-2-enylsulfonylprop-1-ene |
|---|---|
| PubChem CID | 69031048 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;3-prop-2-enylsulfonylprop-1-ene |
| SMILES | C=CCS(=O)(=O)CC=C.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H10O2S/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-3-5-9(7,8)6-4-2/h1-5,8H,6,10H2,(H,11,12);3-4H,1-2,5-6H2 |
| InChIKey | FINHQOMJVPSOTK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|