C11H14N2O4 — CID 25418979
(2R,4R)-2-amino-4-(pyridin-4-ylmethyl)pentanedioic acid (PubChem CID 25418979) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (2R,4R)-2-amino-4-(pyridin-4-ylmethyl)pentanedioic acid.
| Compound Name | (2R,4R)-2-amino-4-(pyridin-4-ylmethyl)pentanedioic acid |
|---|---|
| PubChem CID | 25418979 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2R,4R)-2-amino-4-(pyridin-4-ylmethyl)pentanedioic acid |
| SMILES | N[C@H](C[C@@H](Cc1ccncc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14N2O4/c12-9(11(16)17)6-8(10(14)15)5-7-1-3-13-4-2-7/h1-4,8-9H,5-6,12H2,(H,14,15)(H,16,17)/t8-,9-/m1/s1 |
| InChIKey | RJUNCMAQAGYVHI-RKDXNWHRSA-N |
| XLogP | 0.13 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |