About S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate
S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate (PubChem CID 167273372) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate.
Molecular Properties
| Compound Name | S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate |
| PubChem CID | 167273372 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate |
| SMILES | CSC(=O)[C@@H](N)Cc1ccncc1 |
| InChI | InChI=1S/C9H12N2OS/c1-13-9(12)8(10)6-7-2-4-11-5-3-7/h2-5,8H,6,10H2,1H3/t8-/m0/s1 |
| InChIKey | AQGRVVAOGFKOHM-QMMMGPOBSA-N |
| XLogP | 0.84 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate?
The IUPAC name of S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate (CID 167273372) is S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate.
What is the SMILES notation for S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate?
The canonical SMILES for S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate is CSC(=O)[C@@H](N)Cc1ccncc1.
What is the InChIKey of S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate?
The InChIKey is AQGRVVAOGFKOHM-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-13-9(12)8(10)6-7-2-4-11-5-3-7/h2-5,8H,6,10H2,1H3/t8-/m0/s1.
What are the key properties of S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate?
S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate has a molecular weight of 196.28 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl (2S)-2-amino-3-pyridin-4-ylpropanethioate is sourced from PubChem (CID 167273372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).