C12H16IN3O2 — CID 175802703
2-[[(2S)-2-amino-3-pyridin-4-ylpropanoyl]amino]-2-methylpropanoyl iodide (PubChem CID 175802703) has the molecular formula C12H16IN3O2 and a molecular weight of 361.18 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-3-pyridin-4-ylpropanoyl]amino]-2-methylpropanoyl iodide.
| Compound Name | 2-[[(2S)-2-amino-3-pyridin-4-ylpropanoyl]amino]-2-methylpropanoyl iodide |
|---|---|
| PubChem CID | 175802703 |
| Molecular Formula | C12H16IN3O2 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[[(2S)-2-amino-3-pyridin-4-ylpropanoyl]amino]-2-methylpropanoyl iodide |
| SMILES | CC(C)(NC(=O)[C@@H](N)Cc1ccncc1)C(=O)I |
| InChI | InChI=1S/C12H16IN3O2/c1-12(2,11(13)18)16-10(17)9(14)7-8-3-5-15-6-4-8/h3-6,9H,7,14H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | LXLQRHWRQWEMAX-VIFPVBQESA-N |
| XLogP | 0.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|