C14H21N3O2 — CID 143591085
2-amino-5,5-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)hexanamide (PubChem CID 143591085) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-amino-5,5-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)hexanamide.
| Compound Name | 2-amino-5,5-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 143591085 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-amino-5,5-dimethyl-4-oxo-N-(pyridin-4-ylmethyl)hexanamide |
| SMILES | CC(C)(C)C(=O)CC(N)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,3)12(18)8-11(15)13(19)17-9-10-4-6-16-7-5-10/h4-7,11H,8-9,15H2,1-3H3,(H,17,19) |
| InChIKey | CIYYWZIFRMSUOT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |