C9H15N3O — CID 144877282
ethane;pyridin-4-ylmethylurea (PubChem CID 144877282) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is ethane;pyridin-4-ylmethylurea.
| Compound Name | ethane;pyridin-4-ylmethylurea |
|---|---|
| PubChem CID | 144877282 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | ethane;pyridin-4-ylmethylurea |
| SMILES | CC.NC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C7H9N3O.C2H6/c8-7(11)10-5-6-1-3-9-4-2-6;1-2/h1-4H,5H2,(H3,8,10,11);1-2H3 |
| InChIKey | WPOBSVYZICXBBL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |