C8H15Cl2N5S2 — CID 160816845
pyridin-4-ylmethylcarbamothioylazanium;thiourea;chloride;hydrochloride (PubChem CID 160816845) has the molecular formula C8H15Cl2N5S2 and a molecular weight of 316.28 g/mol. Its IUPAC name is pyridin-4-ylmethylcarbamothioylazanium;thiourea;chloride;hydrochloride.
| Compound Name | pyridin-4-ylmethylcarbamothioylazanium;thiourea;chloride;hydrochloride |
|---|---|
| PubChem CID | 160816845 |
| Molecular Formula | C8H15Cl2N5S2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | pyridin-4-ylmethylcarbamothioylazanium;thiourea;chloride;hydrochloride |
| SMILES | Cl.NC(N)=S.[Cl-].[NH3+]C(=S)NCc1ccncc1 |
| InChI | InChI=1S/C7H9N3S.CH4N2S.2ClH/c8-7(11)10-5-6-1-3-9-4-2-6;2-1(3)4;;/h1-4H,5H2,(H3,8,10,11);(H4,2,3,4);2*1H |
| InChIKey | KMCAMJTXMGDEAH-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|