C18H18N4O2 — CID 21177980
(2S)-3-methylidene-1-N,2-N-bis(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 21177980) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (2S)-3-methylidene-1-N,2-N-bis(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | (2S)-3-methylidene-1-N,2-N-bis(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21177980 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2S)-3-methylidene-1-N,2-N-bis(pyridin-4-ylmethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)NCc2ccncc2)[C@@H]1C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C18H18N4O2/c1-12-15(17(23)21-10-13-2-6-19-7-3-13)16(12)18(24)22-11-14-4-8-20-9-5-14/h2-9,15-16H,1,10-11H2,(H,21,23)(H,22,24)/t15-,16?/m1/s1 |
| InChIKey | AUSIFIHQDUGVGJ-AAFJCEBUSA-N |
| XLogP | 1.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|