C10H14N4O2 — CID 60848280
2-amino-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]acetamide (PubChem CID 60848280) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 60848280 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C10H14N4O2/c11-5-9(15)14-7-10(16)13-6-8-1-3-12-4-2-8/h1-4H,5-7,11H2,(H,13,16)(H,14,15) |
| InChIKey | JZPGNZOXGKUVHI-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |