C15H20FNO4 — CID 70675128
2-amino-4-[[4-(3-(18F)fluoropropyl)phenyl]methyl]pentanedioic acid (PubChem CID 70675128) has the molecular formula C15H20FNO4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-4-[[4-(3-(18F)fluoropropyl)phenyl]methyl]pentanedioic acid.
| Compound Name | 2-amino-4-[[4-(3-(18F)fluoropropyl)phenyl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 70675128 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-4-[[4-(3-(18F)fluoropropyl)phenyl]methyl]pentanedioic acid |
| SMILES | NC(CC(Cc1ccc(CCC[18F])cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20FNO4/c16-7-1-2-10-3-5-11(6-4-10)8-12(14(18)19)9-13(17)15(20)21/h3-6,12-13H,1-2,7-9,17H2,(H,18,19)(H,20,21)/i16-1 |
| InChIKey | CQUUJKMPEXNPCM-GKTGUEEDSA-N |
| XLogP | 1.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |