C17H24FNO4 — CID 70957055
(4S)-4-amino-2-[2-[4-(3-fluoropropyl)phenyl]ethyl]-2-methylpentanedioic acid (PubChem CID 70957055) has the molecular formula C17H24FNO4 and a molecular weight of 325.38 g/mol. Its IUPAC name is (4S)-4-amino-2-[2-[4-(3-fluoropropyl)phenyl]ethyl]-2-methylpentanedioic acid.
| Compound Name | (4S)-4-amino-2-[2-[4-(3-fluoropropyl)phenyl]ethyl]-2-methylpentanedioic acid |
|---|---|
| PubChem CID | 70957055 |
| Molecular Formula | C17H24FNO4 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (4S)-4-amino-2-[2-[4-(3-fluoropropyl)phenyl]ethyl]-2-methylpentanedioic acid |
| SMILES | CC(CCc1ccc(CCCF)cc1)(C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H24FNO4/c1-17(16(22)23,11-14(19)15(20)21)9-8-13-6-4-12(5-7-13)3-2-10-18/h4-7,14H,2-3,8-11,19H2,1H3,(H,20,21)(H,22,23)/t14-,17?/m0/s1 |
| InChIKey | UXQMHDPPDZNLDL-MBIQTGHCSA-N |
| XLogP | 2.41 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |