C22H28O3 — CID 20722165
2-(hydroxymethyl)-2-methyl-4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]butanoic acid (PubChem CID 20722165) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-methyl-4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]butanoic acid.
| Compound Name | 2-(hydroxymethyl)-2-methyl-4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 20722165 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(hydroxymethyl)-2-methyl-4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]butanoic acid |
| SMILES | Cc1ccc(C(C)(C)c2ccc(CCC(C)(CO)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H28O3/c1-16-5-9-18(10-6-16)21(2,3)19-11-7-17(8-12-19)13-14-22(4,15-23)20(24)25/h5-12,23H,13-15H2,1-4H3,(H,24,25) |
| InChIKey | OPONTPIOZGGGHN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |