C17H26O3 — CID 158066900
4-(3-tert-butyl-4-methylphenyl)-2-(hydroxymethyl)-2-methylbutanoic acid (PubChem CID 158066900) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 4-(3-tert-butyl-4-methylphenyl)-2-(hydroxymethyl)-2-methylbutanoic acid.
| Compound Name | 4-(3-tert-butyl-4-methylphenyl)-2-(hydroxymethyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 158066900 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 4-(3-tert-butyl-4-methylphenyl)-2-(hydroxymethyl)-2-methylbutanoic acid |
| SMILES | Cc1ccc(CCC(C)(CO)C(=O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C17H26O3/c1-12-6-7-13(10-14(12)16(2,3)4)8-9-17(5,11-18)15(19)20/h6-7,10,18H,8-9,11H2,1-5H3,(H,19,20) |
| InChIKey | UEWAEUFOEVYPCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |