C17H25FO2 — CID 163777992
(2R)-4-(3-tert-butyl-4-fluorophenyl)-2-ethyl-2-methylbutanoic acid (PubChem CID 163777992) has the molecular formula C17H25FO2 and a molecular weight of 280.38 g/mol. Its IUPAC name is (2R)-4-(3-tert-butyl-4-fluorophenyl)-2-ethyl-2-methylbutanoic acid.
| Compound Name | (2R)-4-(3-tert-butyl-4-fluorophenyl)-2-ethyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 163777992 |
| Molecular Formula | C17H25FO2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2R)-4-(3-tert-butyl-4-fluorophenyl)-2-ethyl-2-methylbutanoic acid |
| SMILES | CC[C@](C)(CCc1ccc(F)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C17H25FO2/c1-6-17(5,15(19)20)10-9-12-7-8-14(18)13(11-12)16(2,3)4/h7-8,11H,6,9-10H2,1-5H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | MMDKXSBAVHVWPC-QGZVFWFLSA-N |
| XLogP | 4.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |