C17H23F3O3 — CID 165028153
(2R)-4-[3-tert-butyl-4-(trifluoromethyl)phenyl]-2-(hydroxymethyl)-2-methylbutanoic acid (PubChem CID 165028153) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2R)-4-[3-tert-butyl-4-(trifluoromethyl)phenyl]-2-(hydroxymethyl)-2-methylbutanoic acid.
| Compound Name | (2R)-4-[3-tert-butyl-4-(trifluoromethyl)phenyl]-2-(hydroxymethyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 165028153 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2R)-4-[3-tert-butyl-4-(trifluoromethyl)phenyl]-2-(hydroxymethyl)-2-methylbutanoic acid |
| SMILES | CC(C)(C)c1cc(CC[C@](C)(CO)C(=O)O)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H23F3O3/c1-15(2,3)13-9-11(5-6-12(13)17(18,19)20)7-8-16(4,10-21)14(22)23/h5-6,9,21H,7-8,10H2,1-4H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | CMMHPGGELPEZMY-MRXNPFEDSA-N |
| XLogP | 4.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |