4-(2,5-dimethylphenyl)butanoic acid

C12H16O2 — CID 15071

IUPAC4-(2,5-dimethylphenyl)butanoic acid
SMILESCc1ccc(C)c(CCCC(=O)O)c1
InChIInChI=1S/C12H16O2/c1-9-6-7-10(2)11(8-9)4-3-5-12(13)14/h6-8H,3-5H2,1-2H3,(H,13,14)
InChIKeyXNTQOUBHYSKYOI-UHFFFAOYSA-N
MW192.26 g/mol
LogP2.71
Rot. Bonds4

About 4-(2,5-dimethylphenyl)butanoic acid

4-(2,5-dimethylphenyl)butanoic acid (PubChem CID 15071) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)butanoic acid.

Molecular Properties

Compound Name4-(2,5-dimethylphenyl)butanoic acid
PubChem CID15071
Molecular FormulaC12H16O2
Molecular Weight192.26 g/mol
Exact Mass192.12
IUPAC Name4-(2,5-dimethylphenyl)butanoic acid
SMILESCc1ccc(C)c(CCCC(=O)O)c1
InChIInChI=1S/C12H16O2/c1-9-6-7-10(2)11(8-9)4-3-5-12(13)14/h6-8H,3-5H2,1-2H3,(H,13,14)
InChIKeyXNTQOUBHYSKYOI-UHFFFAOYSA-N
XLogP2.71
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.26
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-(2,5-dimethylphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dimethylphenyl)butanoic acid?
The IUPAC name of 4-(2,5-dimethylphenyl)butanoic acid (CID 15071) is 4-(2,5-dimethylphenyl)butanoic acid.
What is the SMILES notation for 4-(2,5-dimethylphenyl)butanoic acid?
The canonical SMILES for 4-(2,5-dimethylphenyl)butanoic acid is Cc1ccc(C)c(CCCC(=O)O)c1.
What is the InChIKey of 4-(2,5-dimethylphenyl)butanoic acid?
The InChIKey is XNTQOUBHYSKYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-9-6-7-10(2)11(8-9)4-3-5-12(13)14/h6-8H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 4-(2,5-dimethylphenyl)butanoic acid?
4-(2,5-dimethylphenyl)butanoic acid has a molecular weight of 192.26 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylphenyl)butanoic acid is sourced from PubChem (CID 15071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).