About Ibuprofen, (-)-
Ibuprofen, (-)- (PubChem CID 114864) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is (2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | Ibuprofen, (-)- |
| PubChem CID | 114864 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| SMILES | C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | HEFNNWSXXWATRW-SNVBAGLBSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 203 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Ibuprofen, (-)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ibuprofen, (-)-?
The IUPAC name of Ibuprofen, (-)- (CID 114864) is (2R)-2-[4-(2-methylpropyl)phenyl]propanoic acid.
What is the SMILES notation for Ibuprofen, (-)-?
The canonical SMILES for Ibuprofen, (-)- is C[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)O.
What is the InChIKey of Ibuprofen, (-)-?
The InChIKey is HEFNNWSXXWATRW-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1.
What are the key properties of Ibuprofen, (-)-?
Ibuprofen, (-)- has a molecular weight of 206.28 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Ibuprofen, (-)- is sourced from PubChem (CID 114864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).