About Esflurbiprofen
Esflurbiprofen (PubChem CID 72099) has the molecular formula C15H13FO2
and a molecular weight of 244.26 g/mol. Its IUPAC name is (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid.
Molecular Properties
| Compound Name | Esflurbiprofen |
| PubChem CID | 72099 |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O |
| InChI | InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | SYTBZMRGLBWNTM-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 286 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Esflurbiprofen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Esflurbiprofen?
The IUPAC name of Esflurbiprofen (CID 72099) is (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid.
What is the SMILES notation for Esflurbiprofen?
The canonical SMILES for Esflurbiprofen is C[C@@H](C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)O.
What is the InChIKey of Esflurbiprofen?
The InChIKey is SYTBZMRGLBWNTM-JTQLQIEISA-N. The full InChI is InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)/t10-/m0/s1.
What are the key properties of Esflurbiprofen?
Esflurbiprofen has a molecular weight of 244.26 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Esflurbiprofen is sourced from PubChem (CID 72099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).