C18H28O2 — CID 158066903
(3S)-5-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-3-methylpentan-2-one (PubChem CID 158066903) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (3S)-5-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-3-methylpentan-2-one.
| Compound Name | (3S)-5-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-3-methylpentan-2-one |
|---|---|
| PubChem CID | 158066903 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3S)-5-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-3-methylpentan-2-one |
| SMILES | CC(=O)[C@](C)(CO)CCc1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O2/c1-13-7-8-15(11-16(13)17(3,4)5)9-10-18(6,12-19)14(2)20/h7-8,11,19H,9-10,12H2,1-6H3/t18-/m0/s1 |
| InChIKey | ITXNUWVVRAHXKB-SFHVURJKSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |