C18H30O2 — CID 83939274
1-(3-tert-butyl-4-methylphenyl)heptane-3,4-diol (PubChem CID 83939274) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-methylphenyl)heptane-3,4-diol.
| Compound Name | 1-(3-tert-butyl-4-methylphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83939274 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-(3-tert-butyl-4-methylphenyl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30O2/c1-6-7-16(19)17(20)11-10-14-9-8-13(2)15(12-14)18(3,4)5/h8-9,12,16-17,19-20H,6-7,10-11H2,1-5H3 |
| InChIKey | PLCODTJTYNUKAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |