C20H34O3 — CID 83943134
1-(3-tert-butyl-2-ethoxy-5-methylphenyl)heptane-3,4-diol (PubChem CID 83943134) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(3-tert-butyl-2-ethoxy-5-methylphenyl)heptane-3,4-diol.
| Compound Name | 1-(3-tert-butyl-2-ethoxy-5-methylphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83943134 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1-(3-tert-butyl-2-ethoxy-5-methylphenyl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1cc(C)cc(C(C)(C)C)c1OCC |
| InChI | InChI=1S/C20H34O3/c1-7-9-17(21)18(22)11-10-15-12-14(3)13-16(20(4,5)6)19(15)23-8-2/h12-13,17-18,21-22H,7-11H2,1-6H3 |
| InChIKey | FTKFUZKGLFPHSS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |