C17H28O3 — CID 83942267
1-(3,5-dimethyl-2-propoxyphenyl)hexane-3,4-diol (PubChem CID 83942267) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-propoxyphenyl)hexane-3,4-diol.
| Compound Name | 1-(3,5-dimethyl-2-propoxyphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83942267 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-(3,5-dimethyl-2-propoxyphenyl)hexane-3,4-diol |
| SMILES | CCCOc1c(C)cc(C)cc1CCC(O)C(O)CC |
| InChI | InChI=1S/C17H28O3/c1-5-9-20-17-13(4)10-12(3)11-14(17)7-8-16(19)15(18)6-2/h10-11,15-16,18-19H,5-9H2,1-4H3 |
| InChIKey | HHXKSLBQBLFFAG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |