C17H27ClO3 — CID 83937827
1-(5-chloro-4-methyl-2-propoxyphenyl)heptane-3,4-diol (PubChem CID 83937827) has the molecular formula C17H27ClO3 and a molecular weight of 314.85 g/mol. Its IUPAC name is 1-(5-chloro-4-methyl-2-propoxyphenyl)heptane-3,4-diol.
| Compound Name | 1-(5-chloro-4-methyl-2-propoxyphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83937827 |
| Molecular Formula | C17H27ClO3 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(5-chloro-4-methyl-2-propoxyphenyl)heptane-3,4-diol |
| SMILES | CCCOc1cc(C)c(Cl)cc1CCC(O)C(O)CCC |
| InChI | InChI=1S/C17H27ClO3/c1-4-6-15(19)16(20)8-7-13-11-14(18)12(3)10-17(13)21-9-5-2/h10-11,15-16,19-20H,4-9H2,1-3H3 |
| InChIKey | RLOKVGPXUHKSSI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |