C16H25FO3 — CID 83944242
1-(5-fluoro-2-propoxyphenyl)heptane-3,4-diol (PubChem CID 83944242) has the molecular formula C16H25FO3 and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(5-fluoro-2-propoxyphenyl)heptane-3,4-diol.
| Compound Name | 1-(5-fluoro-2-propoxyphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83944242 |
| Molecular Formula | C16H25FO3 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(5-fluoro-2-propoxyphenyl)heptane-3,4-diol |
| SMILES | CCCOc1ccc(F)cc1CCC(O)C(O)CCC |
| InChI | InChI=1S/C16H25FO3/c1-3-5-14(18)15(19)8-6-12-11-13(17)7-9-16(12)20-10-4-2/h7,9,11,14-15,18-19H,3-6,8,10H2,1-2H3 |
| InChIKey | WXBPPSZFVKJKCW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |