C14H22O2 — CID 83928188
1-(2,5-dimethylphenyl)hexane-3,4-diol (PubChem CID 83928188) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)hexane-3,4-diol.
| Compound Name | 1-(2,5-dimethylphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83928188 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)hexane-3,4-diol |
| SMILES | CCC(O)C(O)CCc1cc(C)ccc1C |
| InChI | InChI=1S/C14H22O2/c1-4-13(15)14(16)8-7-12-9-10(2)5-6-11(12)3/h5-6,9,13-16H,4,7-8H2,1-3H3 |
| InChIKey | MEJDTCWSNQQIIT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |