C15H24O2 — CID 138511161
(3S,4S)-8-(2-methylphenyl)octane-3,4-diol (PubChem CID 138511161) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is (3S,4S)-8-(2-methylphenyl)octane-3,4-diol.
| Compound Name | (3S,4S)-8-(2-methylphenyl)octane-3,4-diol |
|---|---|
| PubChem CID | 138511161 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3S,4S)-8-(2-methylphenyl)octane-3,4-diol |
| SMILES | CC[C@H](O)[C@@H](O)CCCCc1ccccc1C |
| InChI | InChI=1S/C15H24O2/c1-3-14(16)15(17)11-7-6-10-13-9-5-4-8-12(13)2/h4-5,8-9,14-17H,3,6-7,10-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | YRKGSXZDZDATFF-GJZGRUSLSA-N |
| XLogP | 2.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|