C14H22O3 — CID 83936503
1-(4-methoxy-2-methylphenyl)hexane-3,4-diol (PubChem CID 83936503) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)hexane-3,4-diol.
| Compound Name | 1-(4-methoxy-2-methylphenyl)hexane-3,4-diol |
|---|---|
| PubChem CID | 83936503 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)hexane-3,4-diol |
| SMILES | CCC(O)C(O)CCc1ccc(OC)cc1C |
| InChI | InChI=1S/C14H22O3/c1-4-13(15)14(16)8-6-11-5-7-12(17-3)9-10(11)2/h5,7,9,13-16H,4,6,8H2,1-3H3 |
| InChIKey | NULIJOUKGPTAHU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |