C13H19FO2 — CID 102878488
1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-3-ol (PubChem CID 102878488) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-3-ol.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 102878488 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-3-ol |
| SMILES | COc1ccc(CCC(O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C13H19FO2/c1-9(2)13(15)7-5-10-4-6-11(16-3)8-12(10)14/h4,6,8-9,13,15H,5,7H2,1-3H3 |
| InChIKey | VPXIPKFRNKSWIA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |