C9H9FO — CID 59418410
CID 59418410 (PubChem CID 59418410) has the molecular formula C9H9FO and a molecular weight of 152.17 g/mol.
| Compound Name | CID 59418410 |
|---|---|
| PubChem CID | 59418410 |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | — |
| SMILES | [CH]Cc1ccc(OC)cc1F |
| InChI | InChI=1S/C9H9FO/c1-3-7-4-5-8(11-2)6-9(7)10/h1,4-6H,3H2,2H3 |
| InChIKey | RTDNUDHFHHSXLB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |