C15H24FNO — CID 103396754
1-(2-fluoro-4-methoxyphenyl)-N,4,4-trimethylpentan-3-amine (PubChem CID 103396754) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-N,4,4-trimethylpentan-3-amine.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-N,4,4-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 103396754 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-N,4,4-trimethylpentan-3-amine |
| SMILES | CNC(CCc1ccc(OC)cc1F)C(C)(C)C |
| InChI | InChI=1S/C15H24FNO/c1-15(2,3)14(17-4)9-7-11-6-8-12(18-5)10-13(11)16/h6,8,10,14,17H,7,9H2,1-5H3 |
| InChIKey | YPEKDSSTKVGUEN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |