C20H26O3 — CID 83937321
1-(2-methyl-4-phenoxyphenyl)heptane-3,4-diol (PubChem CID 83937321) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-(2-methyl-4-phenoxyphenyl)heptane-3,4-diol.
| Compound Name | 1-(2-methyl-4-phenoxyphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83937321 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-(2-methyl-4-phenoxyphenyl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1ccc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C20H26O3/c1-3-7-19(21)20(22)13-11-16-10-12-18(14-15(16)2)23-17-8-5-4-6-9-17/h4-6,8-10,12,14,19-22H,3,7,11,13H2,1-2H3 |
| InChIKey | BNHVHUBQQMULKB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |