About 2-methyl-4-phenoxyphenol
2-methyl-4-phenoxyphenol (PubChem CID 23089676) has the molecular formula C13H12O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-methyl-4-phenoxyphenol.
Molecular Properties
| Compound Name | 2-methyl-4-phenoxyphenol |
| PubChem CID | 23089676 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-methyl-4-phenoxyphenol |
| SMILES | Cc1cc(Oc2ccccc2)ccc1O |
| InChI | InChI=1S/C13H12O2/c1-10-9-12(7-8-13(10)14)15-11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | SFFXWJSLVRAIKN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenoxyphenol?
The IUPAC name of 2-methyl-4-phenoxyphenol (CID 23089676) is 2-methyl-4-phenoxyphenol.
What is the SMILES notation for 2-methyl-4-phenoxyphenol?
The canonical SMILES for 2-methyl-4-phenoxyphenol is Cc1cc(Oc2ccccc2)ccc1O.
What is the InChIKey of 2-methyl-4-phenoxyphenol?
The InChIKey is SFFXWJSLVRAIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2/c1-10-9-12(7-8-13(10)14)15-11-5-3-2-4-6-11/h2-9,14H,1H3.
What are the key properties of 2-methyl-4-phenoxyphenol?
2-methyl-4-phenoxyphenol has a molecular weight of 200.24 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenoxyphenol is sourced from PubChem (CID 23089676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).