About 1-ethyl-3-phenoxybenzene;2-methylphenol
1-ethyl-3-phenoxybenzene;2-methylphenol (PubChem CID 142875210) has the molecular formula C21H22O2
and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-ethyl-3-phenoxybenzene;2-methylphenol.
Molecular Properties
| Compound Name | 1-ethyl-3-phenoxybenzene;2-methylphenol |
| PubChem CID | 142875210 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-ethyl-3-phenoxybenzene;2-methylphenol |
| SMILES | CCc1cccc(Oc2ccccc2)c1.Cc1ccccc1O |
| InChI | InChI=1S/C14H14O.C7H8O/c1-2-12-7-6-10-14(11-12)15-13-8-4-3-5-9-13;1-6-4-2-3-5-7(6)8/h3-11H,2H2,1H3;2-5,8H,1H3 |
| InChIKey | INNLPCZHQNQATC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-3-phenoxybenzene;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-phenoxybenzene;2-methylphenol?
The IUPAC name of 1-ethyl-3-phenoxybenzene;2-methylphenol (CID 142875210) is 1-ethyl-3-phenoxybenzene;2-methylphenol.
What is the SMILES notation for 1-ethyl-3-phenoxybenzene;2-methylphenol?
The canonical SMILES for 1-ethyl-3-phenoxybenzene;2-methylphenol is CCc1cccc(Oc2ccccc2)c1.Cc1ccccc1O.
What is the InChIKey of 1-ethyl-3-phenoxybenzene;2-methylphenol?
The InChIKey is INNLPCZHQNQATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C7H8O/c1-2-12-7-6-10-14(11-12)15-13-8-4-3-5-9-13;1-6-4-2-3-5-7(6)8/h3-11H,2H2,1H3;2-5,8H,1H3.
What are the key properties of 1-ethyl-3-phenoxybenzene;2-methylphenol?
1-ethyl-3-phenoxybenzene;2-methylphenol has a molecular weight of 306.40 g/mol, XLogP of 5.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-phenoxybenzene;2-methylphenol is sourced from PubChem (CID 142875210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).