C22H20O5 — CID 129220866
3-(2-methyl-4-phenoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one (PubChem CID 129220866) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-(2-methyl-4-phenoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one.
| Compound Name | 3-(2-methyl-4-phenoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 129220866 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-(2-methyl-4-phenoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| SMILES | Cc1cc(Oc2ccccc2)ccc1CCC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C22H20O5/c1-14-11-18(27-17-5-3-2-4-6-17)9-7-15(14)8-10-19(24)22-20(25)12-16(23)13-21(22)26/h2-7,9,11-13,23,25-26H,8,10H2,1H3 |
| InChIKey | AWQWXUGLHQKHKV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |