C21H18FNO5 — CID 139467157
N-[[4-(4-fluorophenoxy)-2-methylphenyl]methyl]-2,4,6-trihydroxybenzamide (PubChem CID 139467157) has the molecular formula C21H18FNO5 and a molecular weight of 383.38 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)-2-methylphenyl]methyl]-2,4,6-trihydroxybenzamide.
| Compound Name | N-[[4-(4-fluorophenoxy)-2-methylphenyl]methyl]-2,4,6-trihydroxybenzamide |
|---|---|
| PubChem CID | 139467157 |
| Molecular Formula | C21H18FNO5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)-2-methylphenyl]methyl]-2,4,6-trihydroxybenzamide |
| SMILES | Cc1cc(Oc2ccc(F)cc2)ccc1CNC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C21H18FNO5/c1-12-8-17(28-16-6-3-14(22)4-7-16)5-2-13(12)11-23-21(27)20-18(25)9-15(24)10-19(20)26/h2-10,24-26H,11H2,1H3,(H,23,27) |
| InChIKey | YDYCIFFKQZNVSK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |