C21H15FO5 — CID 129220919
(E)-3-[4-(4-fluorophenoxy)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 129220919) has the molecular formula C21H15FO5 and a molecular weight of 366.34 g/mol. Its IUPAC name is (E)-3-[4-(4-fluorophenoxy)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(4-fluorophenoxy)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 129220919 |
| Molecular Formula | C21H15FO5 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (E)-3-[4-(4-fluorophenoxy)phenyl]-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Oc2ccc(F)cc2)cc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C21H15FO5/c22-14-4-8-17(9-5-14)27-16-6-1-13(2-7-16)3-10-18(24)21-19(25)11-15(23)12-20(21)26/h1-12,23,25-26H/b10-3+ |
| InChIKey | QMDUUKZYWVEDNZ-XCVCLJGOSA-N |
| XLogP | 4.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|