C13H10O4S — CID 101145924
(E)-3-thiophen-3-yl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 101145924) has the molecular formula C13H10O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is (E)-3-thiophen-3-yl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-thiophen-3-yl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101145924 |
| Molecular Formula | C13H10O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | (E)-3-thiophen-3-yl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccsc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C13H10O4S/c14-9-5-11(16)13(12(17)6-9)10(15)2-1-8-3-4-18-7-8/h1-7,14,16-17H/b2-1+ |
| InChIKey | TWLFYNGMFWLRLF-OWOJBTEDSA-N |
| XLogP | 2.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|