C15H12O8S — CID 131834450
[4-[(E)-3-oxo-3-(2,4,6-trihydroxyphenyl)prop-1-enyl]phenyl] hydrogen sulfate (PubChem CID 131834450) has the molecular formula C15H12O8S and a molecular weight of 352.32 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-(2,4,6-trihydroxyphenyl)prop-1-enyl]phenyl] hydrogen sulfate.
| Compound Name | [4-[(E)-3-oxo-3-(2,4,6-trihydroxyphenyl)prop-1-enyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 131834450 |
| Molecular Formula | C15H12O8S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [4-[(E)-3-oxo-3-(2,4,6-trihydroxyphenyl)prop-1-enyl]phenyl] hydrogen sulfate |
| SMILES | O=C(/C=C/c1ccc(OS(=O)(=O)O)cc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H12O8S/c16-10-7-13(18)15(14(19)8-10)12(17)6-3-9-1-4-11(5-2-9)23-24(20,21)22/h1-8,16,18-19H,(H,20,21,22)/b6-3+ |
| InChIKey | OERQVDUPRGOEHR-ZZXKWVIFSA-N |
| XLogP | 1.88 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|