C14H11KO6S — CID 46855201
potassium [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] sulfate (PubChem CID 46855201) has the molecular formula C14H11KO6S and a molecular weight of 346.40 g/mol. Its IUPAC name is potassium [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] sulfate.
| Compound Name | potassium [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] sulfate |
|---|---|
| PubChem CID | 46855201 |
| Molecular Formula | C14H11KO6S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | potassium [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl] sulfate |
| SMILES | O=S(=O)([O-])Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1.[K+] |
| InChI | InChI=1S/C14H12O6S.K/c15-12-7-11(8-13(16)9-12)2-1-10-3-5-14(6-4-10)20-21(17,18)19;/h1-9,15-16H,(H,17,18,19);/q;+1/p-1/b2-1+; |
| InChIKey | DBEZAQWZIMHBRG-TYYBGVCCSA-M |
| XLogP | -0.89 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|