C14H12O5S — CID 173073405
4-[2-(3,5-dihydroxyphenyl)ethenyl]benzenesulfonic acid (PubChem CID 173073405) has the molecular formula C14H12O5S and a molecular weight of 292.31 g/mol. Its IUPAC name is 4-[2-(3,5-dihydroxyphenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 4-[2-(3,5-dihydroxyphenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173073405 |
| Molecular Formula | C14H12O5S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-[2-(3,5-dihydroxyphenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O5S/c15-12-7-11(8-13(16)9-12)2-1-10-3-5-14(6-4-10)20(17,18)19/h1-9,15-16H,(H,17,18,19) |
| InChIKey | UIKXFXKOAPAGGZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|