C13H12O9S3 — CID 159013047
4-[(3,5-dihydroxyphenyl)sulfonylmethylsulfonyl]benzenesulfonic acid (PubChem CID 159013047) has the molecular formula C13H12O9S3 and a molecular weight of 408.43 g/mol. Its IUPAC name is 4-[(3,5-dihydroxyphenyl)sulfonylmethylsulfonyl]benzenesulfonic acid.
| Compound Name | 4-[(3,5-dihydroxyphenyl)sulfonylmethylsulfonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 159013047 |
| Molecular Formula | C13H12O9S3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 4-[(3,5-dihydroxyphenyl)sulfonylmethylsulfonyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(S(=O)(=O)CS(=O)(=O)c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C13H12O9S3/c14-9-5-10(15)7-13(6-9)24(18,19)8-23(16,17)11-1-3-12(4-2-11)25(20,21)22/h1-7,14-15H,8H2,(H,20,21,22) |
| InChIKey | FDAUYCWSGFKIPW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|