C14H15O7P — CID 25189491
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;phosphoric acid (PubChem CID 25189491) has the molecular formula C14H15O7P and a molecular weight of 326.24 g/mol. Its IUPAC name is 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;phosphoric acid.
| Compound Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;phosphoric acid |
|---|---|
| PubChem CID | 25189491 |
| Molecular Formula | C14H15O7P |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.H3O4P/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;1-5(2,3)4/h1-9,15-17H;(H3,1,2,3,4)/b2-1+; |
| InChIKey | ANCSKBYZVKUEAP-TYYBGVCCSA-N |
| XLogP | 2.05 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|