C18H20O5 — CID 175502826
ethyl acetate;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 175502826) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is ethyl acetate;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | ethyl acetate;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 175502826 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl acetate;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | CCOC(C)=O.Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.C4H8O2/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;1-3-6-4(2)5/h1-9,15-17H;3H2,1-2H3 |
| InChIKey | WDUUVLRCRQDRAS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|