C26H36O8S — CID 175188327
acetic acid;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;octanethioic S-acid (PubChem CID 175188327) has the molecular formula C26H36O8S and a molecular weight of 508.63 g/mol. Its IUPAC name is acetic acid;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;octanethioic S-acid.
| Compound Name | acetic acid;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;octanethioic S-acid |
|---|---|
| PubChem CID | 175188327 |
| Molecular Formula | C26H36O8S |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | acetic acid;5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;octanethioic S-acid |
| SMILES | CC(=O)O.CC(=O)O.CCCCCCCC(=O)S.Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.C8H16OS.2C2H4O2/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;1-2-3-4-5-6-7-8(9)10;2*1-2(3)4/h1-9,15-17H;2-7H2,1H3,(H,9,10);2*1H3,(H,3,4) |
| InChIKey | KWNHQJIIECBBBK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|