C16H15NO3 — CID 68956435
2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl]acetamide (PubChem CID 68956435) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl]acetamide.
| Compound Name | 2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 68956435 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C16H15NO3/c17-16(20)9-12-4-1-11(2-5-12)3-6-13-7-14(18)10-15(19)8-13/h1-8,10,18-19H,9H2,(H2,17,20)/b6-3+ |
| InChIKey | VYKNUMXVYKRHSR-ZZXKWVIFSA-N |
| XLogP | 2.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|