C8H11NO6S — CID 155147372
2-(4-hydroxyphenyl)acetamide;sulfuric acid (PubChem CID 155147372) has the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)acetamide;sulfuric acid.
| Compound Name | 2-(4-hydroxyphenyl)acetamide;sulfuric acid |
|---|---|
| PubChem CID | 155147372 |
| Molecular Formula | C8H11NO6S |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2-(4-hydroxyphenyl)acetamide;sulfuric acid |
| SMILES | NC(=O)Cc1ccc(O)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H9NO2.H2O4S/c9-8(11)5-6-1-3-7(10)4-2-6;1-5(2,3)4/h1-4,10H,5H2,(H2,9,11);(H2,1,2,3,4) |
| InChIKey | YQROKXAXRPNVCV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|