2-(4-hydroxyphenyl)acetamide;sulfuric acid

C8H11NO6S — CID 155147372

IUPAC2-(4-hydroxyphenyl)acetamide;sulfuric acid
SMILESNC(=O)Cc1ccc(O)cc1.O=S(=O)(O)O
InChIInChI=1S/C8H9NO2.H2O4S/c9-8(11)5-6-1-3-7(10)4-2-6;1-5(2,3)4/h1-4,10H,5H2,(H2,9,11);(H2,1,2,3,4)
InChIKeyYQROKXAXRPNVCV-UHFFFAOYSA-N
MW249.24 g/mol
LogP-0.23
Rot. Bonds2

About 2-(4-hydroxyphenyl)acetamide;sulfuric acid

2-(4-hydroxyphenyl)acetamide;sulfuric acid (PubChem CID 155147372) has the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)acetamide;sulfuric acid.

Molecular Properties

Compound Name2-(4-hydroxyphenyl)acetamide;sulfuric acid
PubChem CID155147372
Molecular FormulaC8H11NO6S
Molecular Weight249.24 g/mol
Exact Mass249.03
IUPAC Name2-(4-hydroxyphenyl)acetamide;sulfuric acid
SMILESNC(=O)Cc1ccc(O)cc1.O=S(=O)(O)O
InChIInChI=1S/C8H9NO2.H2O4S/c9-8(11)5-6-1-3-7(10)4-2-6;1-5(2,3)4/h1-4,10H,5H2,(H2,9,11);(H2,1,2,3,4)
InChIKeyYQROKXAXRPNVCV-UHFFFAOYSA-N
XLogP-0.23
TPSA137.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.24
LogP ≤ 5-0.23
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(4-hydroxyphenyl)acetamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxyphenyl)acetamide;sulfuric acid?
The IUPAC name of 2-(4-hydroxyphenyl)acetamide;sulfuric acid (CID 155147372) is 2-(4-hydroxyphenyl)acetamide;sulfuric acid.
What is the SMILES notation for 2-(4-hydroxyphenyl)acetamide;sulfuric acid?
The canonical SMILES for 2-(4-hydroxyphenyl)acetamide;sulfuric acid is NC(=O)Cc1ccc(O)cc1.O=S(=O)(O)O.
What is the InChIKey of 2-(4-hydroxyphenyl)acetamide;sulfuric acid?
The InChIKey is YQROKXAXRPNVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.H2O4S/c9-8(11)5-6-1-3-7(10)4-2-6;1-5(2,3)4/h1-4,10H,5H2,(H2,9,11);(H2,1,2,3,4).
What are the key properties of 2-(4-hydroxyphenyl)acetamide;sulfuric acid?
2-(4-hydroxyphenyl)acetamide;sulfuric acid has a molecular weight of 249.24 g/mol, XLogP of -0.23, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)acetamide;sulfuric acid is sourced from PubChem (CID 155147372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).