C9H12N2O3S — CID 118211828
2-[4-(methylsulfamoyl)phenyl]acetamide (PubChem CID 118211828) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-[4-(methylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[4-(methylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 118211828 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-[4-(methylsulfamoyl)phenyl]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-11-15(13,14)8-4-2-7(3-5-8)6-9(10)12/h2-5,11H,6H2,1H3,(H2,10,12) |
| InChIKey | JBTGPDZXIXQVKO-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |